C22H20Cl2F3NO2 — CID 123614323
3-[2-chloro-5-(4-chlorophenyl)phenyl]-8-(trifluoromethyl)azecane-2,4-dione (PubChem CID 123614323) has the molecular formula C22H20Cl2F3NO2 and a molecular weight of 458.31 g/mol. Its IUPAC name is 3-[2-chloro-5-(4-chlorophenyl)phenyl]-8-(trifluoromethyl)azecane-2,4-dione.
| Compound Name | 3-[2-chloro-5-(4-chlorophenyl)phenyl]-8-(trifluoromethyl)azecane-2,4-dione |
|---|---|
| PubChem CID | 123614323 |
| Molecular Formula | C22H20Cl2F3NO2 |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 3-[2-chloro-5-(4-chlorophenyl)phenyl]-8-(trifluoromethyl)azecane-2,4-dione |
| SMILES | O=C1CCCC(C(F)(F)F)CCNC(=O)C1c1cc(-c2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C22H20Cl2F3NO2/c23-16-7-4-13(5-8-16)14-6-9-18(24)17(12-14)20-19(29)3-1-2-15(22(25,26)27)10-11-28-21(20)30/h4-9,12,15,20H,1-3,10-11H2,(H,28,30) |
| InChIKey | NOLHCQYODFVZDR-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|