About 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine
3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine (PubChem CID 160505997) has the molecular formula C17H27ClN2O
and a molecular weight of 310.87 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine |
| PubChem CID | 160505997 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)NC(C)C.O=C1NCCC1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClNO.C6H15N/c12-10-3-1-8(2-4-10)7-9-5-6-13-11(9)14;1-5(2)7-6(3)4/h1-4,9H,5-7H2,(H,13,14);5-7H,1-4H3 |
| InChIKey | QSKIABYORTWUOC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine?
The IUPAC name of 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine (CID 160505997) is 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine.
What is the SMILES notation for 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine?
The canonical SMILES for 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine is CC(C)NC(C)C.O=C1NCCC1Cc1ccc(Cl)cc1.
What is the InChIKey of 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine?
The InChIKey is QSKIABYORTWUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO.C6H15N/c12-10-3-1-8(2-4-10)7-9-5-6-13-11(9)14;1-5(2)7-6(3)4/h1-4,9H,5-7H2,(H,13,14);5-7H,1-4H3.
What are the key properties of 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine?
3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine has a molecular weight of 310.87 g/mol, XLogP of 3.41, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chlorophenyl)methyl]pyrrolidin-2-one;N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 160505997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).