C25H24ClFO2 — CID 123294870
(2R,6S)-4-[5-(4-chloro-3-fluorophenyl)-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione (PubChem CID 123294870) has the molecular formula C25H24ClFO2 and a molecular weight of 410.92 g/mol. Its IUPAC name is (2R,6S)-4-[5-(4-chloro-3-fluorophenyl)-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione.
| Compound Name | (2R,6S)-4-[5-(4-chloro-3-fluorophenyl)-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 123294870 |
| Molecular Formula | C25H24ClFO2 |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (2R,6S)-4-[5-(4-chloro-3-fluorophenyl)-2-ethylphenyl]tricyclo[5.2.2.02,6]undecane-3,5-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)c(F)c2)cc1C1C(=O)[C@@H]2C3CCC(CC3)[C@@H]2C1=O |
| InChI | InChI=1S/C25H24ClFO2/c1-2-13-3-8-16(17-9-10-19(26)20(27)12-17)11-18(13)23-24(28)21-14-4-5-15(7-6-14)22(21)25(23)29/h3,8-12,14-15,21-23H,2,4-7H2,1H3/t14?,15?,21-,22+,23? |
| InChIKey | GMGDLYKIUGRPED-MKYUJSDCSA-N |
| XLogP | 6.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|