C22H19ClO2 — CID 131731828
3-[5-(4-chlorophenyl)-2-ethylphenyl]bicyclo[3.2.1]oct-6-ene-2,4-dione (PubChem CID 131731828) has the molecular formula C22H19ClO2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-2-ethylphenyl]bicyclo[3.2.1]oct-6-ene-2,4-dione.
| Compound Name | 3-[5-(4-chlorophenyl)-2-ethylphenyl]bicyclo[3.2.1]oct-6-ene-2,4-dione |
|---|---|
| PubChem CID | 131731828 |
| Molecular Formula | C22H19ClO2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-2-ethylphenyl]bicyclo[3.2.1]oct-6-ene-2,4-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2)cc1C1C(=O)C2C=CC(C2)C1=O |
| InChI | InChI=1S/C22H19ClO2/c1-2-13-3-4-15(14-7-9-18(23)10-8-14)12-19(13)20-21(24)16-5-6-17(11-16)22(20)25/h3-10,12,16-17,20H,2,11H2,1H3 |
| InChIKey | AKCGLSWEEJPZKX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|