C22H23ClO2 — CID 123311699
2-[5-(4-chlorophenyl)-2-ethylphenyl]-4,4-dimethylcyclohexane-1,3-dione (PubChem CID 123311699) has the molecular formula C22H23ClO2 and a molecular weight of 354.88 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-2-ethylphenyl]-4,4-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[5-(4-chlorophenyl)-2-ethylphenyl]-4,4-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 123311699 |
| Molecular Formula | C22H23ClO2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-2-ethylphenyl]-4,4-dimethylcyclohexane-1,3-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2)cc1C1C(=O)CCC(C)(C)C1=O |
| InChI | InChI=1S/C22H23ClO2/c1-4-14-5-6-16(15-7-9-17(23)10-8-15)13-18(14)20-19(24)11-12-22(2,3)21(20)25/h5-10,13,20H,4,11-12H2,1-3H3 |
| InChIKey | VXADTAORZGQBSH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|