C25H24Cl2O3 — CID 123662326
(1R,2S,6R,7S)-4-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-1,7-dimethyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 123662326) has the molecular formula C25H24Cl2O3 and a molecular weight of 443.37 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-1,7-dimethyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-1,7-dimethyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 123662326 |
| Molecular Formula | C25H24Cl2O3 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | (1R,2S,6R,7S)-4-[5-(2,4-dichlorophenyl)-2-ethylphenyl]-1,7-dimethyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2Cl)cc1C1C(=O)[C@@H]2[C@H](C1=O)[C@@]1(C)CC[C@]2(C)O1 |
| InChI | InChI=1S/C25H24Cl2O3/c1-4-13-5-6-14(16-8-7-15(26)12-18(16)27)11-17(13)19-22(28)20-21(23(19)29)25(3)10-9-24(20,2)30-25/h5-8,11-12,19-21H,4,9-10H2,1-3H3/t19?,20-,21+,24-,25+ |
| InChIKey | QVLDGXOPJYWOFC-MDYAQFSDSA-N |
| XLogP | 6.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|