C24H24Cl2O3 — CID 91108411
6-[5-(2,5-dichlorophenyl)-2-ethylphenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 91108411) has the molecular formula C24H24Cl2O3 and a molecular weight of 431.36 g/mol. Its IUPAC name is 6-[5-(2,5-dichlorophenyl)-2-ethylphenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-[5-(2,5-dichlorophenyl)-2-ethylphenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 91108411 |
| Molecular Formula | C24H24Cl2O3 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 6-[5-(2,5-dichlorophenyl)-2-ethylphenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CCc1ccc(-c2cc(Cl)ccc2Cl)cc1C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C24H24Cl2O3/c1-6-13-7-8-14(16-12-15(25)9-10-18(16)26)11-17(13)19-20(27)23(2,3)22(29)24(4,5)21(19)28/h7-12,19H,6H2,1-5H3 |
| InChIKey | RJSAKNLUEGVUSN-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|