C25H27ClO3 — CID 91295744
6-[5-(4-chloro-2-methylphenyl)-2-ethylphenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 91295744) has the molecular formula C25H27ClO3 and a molecular weight of 410.94 g/mol. Its IUPAC name is 6-[5-(4-chloro-2-methylphenyl)-2-ethylphenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-[5-(4-chloro-2-methylphenyl)-2-ethylphenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 91295744 |
| Molecular Formula | C25H27ClO3 |
| Molecular Weight | 410.94 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 6-[5-(4-chloro-2-methylphenyl)-2-ethylphenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2C)cc1C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C25H27ClO3/c1-7-15-8-9-16(18-11-10-17(26)12-14(18)2)13-19(15)20-21(27)24(3,4)23(29)25(5,6)22(20)28/h8-13,20H,7H2,1-6H3 |
| InChIKey | FZWHEOBBIOYRSB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.94 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|