C27H32O3S — CID 90840561
6-[2-ethyl-5-(4-propan-2-ylsulfanylphenyl)phenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 90840561) has the molecular formula C27H32O3S and a molecular weight of 436.62 g/mol. Its IUPAC name is 6-[2-ethyl-5-(4-propan-2-ylsulfanylphenyl)phenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-[2-ethyl-5-(4-propan-2-ylsulfanylphenyl)phenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 90840561 |
| Molecular Formula | C27H32O3S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 6-[2-ethyl-5-(4-propan-2-ylsulfanylphenyl)phenyl]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CCc1ccc(-c2ccc(SC(C)C)cc2)cc1C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C27H32O3S/c1-8-17-9-10-19(18-11-13-20(14-12-18)31-16(2)3)15-21(17)22-23(28)26(4,5)25(30)27(6,7)24(22)29/h9-16,22H,8H2,1-7H3 |
| InChIKey | OVFBVHZMNHYOAM-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|