C22H21Cl2FO2 — CID 123335839
2-[5-(2,4-dichloro-6-fluorophenyl)-2-ethylphenyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 123335839) has the molecular formula C22H21Cl2FO2 and a molecular weight of 407.31 g/mol. Its IUPAC name is 2-[5-(2,4-dichloro-6-fluorophenyl)-2-ethylphenyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[5-(2,4-dichloro-6-fluorophenyl)-2-ethylphenyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 123335839 |
| Molecular Formula | C22H21Cl2FO2 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-[5-(2,4-dichloro-6-fluorophenyl)-2-ethylphenyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CCc1ccc(-c2c(F)cc(Cl)cc2Cl)cc1C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C22H21Cl2FO2/c1-4-12-5-6-13(20-16(24)8-14(23)9-17(20)25)7-15(12)21-18(26)10-22(2,3)11-19(21)27/h5-9,21H,4,10-11H2,1-3H3 |
| InChIKey | WSZBMFAWPXFNCH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|