C22H20Cl2O2 — CID 90726045
(1R,5S)-3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 90726045) has the molecular formula C22H20Cl2O2 and a molecular weight of 387.31 g/mol. Its IUPAC name is (1R,5S)-3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S)-3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 90726045 |
| Molecular Formula | C22H20Cl2O2 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | (1R,5S)-3-[5-(2,4-dichlorophenyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2Cl)cc1C1C(=O)[C@@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C22H20Cl2O2/c1-2-12-3-4-13(17-8-7-16(23)11-19(17)24)10-18(12)20-21(25)14-5-6-15(9-14)22(20)26/h3-4,7-8,10-11,14-15,20H,2,5-6,9H2,1H3/t14-,15+,20? |
| InChIKey | LMTLMYNLBANIKY-DBIVSCPCSA-N |
| XLogP | 5.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|