C21H20ClNO2 — CID 90822543
(1S,5R)-3-[5-(5-chloro-2-pyridinyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 90822543) has the molecular formula C21H20ClNO2 and a molecular weight of 353.85 g/mol. Its IUPAC name is (1S,5R)-3-[5-(5-chloro-2-pyridinyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1S,5R)-3-[5-(5-chloro-2-pyridinyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 90822543 |
| Molecular Formula | C21H20ClNO2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (1S,5R)-3-[5-(5-chloro-2-pyridinyl)-2-ethylphenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)cn2)cc1C1C(=O)[C@@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C21H20ClNO2/c1-2-12-3-4-13(18-8-7-16(22)11-23-18)10-17(12)19-20(24)14-5-6-15(9-14)21(19)25/h3-4,7-8,10-11,14-15,19H,2,5-6,9H2,1H3/t14-,15+,19? |
| InChIKey | DIAQOHBBJOBUSI-RTHVDDQRSA-N |
| XLogP | 4.62 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|