C22H21FO2 — CID 91369697
(1R,5S)-3-[2-ethyl-5-(4-fluorophenyl)phenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 91369697) has the molecular formula C22H21FO2 and a molecular weight of 336.41 g/mol. Its IUPAC name is (1R,5S)-3-[2-ethyl-5-(4-fluorophenyl)phenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S)-3-[2-ethyl-5-(4-fluorophenyl)phenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 91369697 |
| Molecular Formula | C22H21FO2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (1R,5S)-3-[2-ethyl-5-(4-fluorophenyl)phenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(-c2ccc(F)cc2)cc1C1C(=O)[C@@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C22H21FO2/c1-2-13-3-4-15(14-7-9-18(23)10-8-14)12-19(13)20-21(24)16-5-6-17(11-16)22(20)25/h3-4,7-10,12,16-17,20H,2,5-6,11H2,1H3/t16-,17+,20? |
| InChIKey | MLHJMHDSGCURBD-XEWABKELSA-N |
| XLogP | 4.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|