C25H28ClFO3 — CID 91440693
4-[5-(4-chloro-2-ethyl-3-fluorophenyl)-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione (PubChem CID 91440693) has the molecular formula C25H28ClFO3 and a molecular weight of 430.95 g/mol. Its IUPAC name is 4-[5-(4-chloro-2-ethyl-3-fluorophenyl)-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione.
| Compound Name | 4-[5-(4-chloro-2-ethyl-3-fluorophenyl)-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
|---|---|
| PubChem CID | 91440693 |
| Molecular Formula | C25H28ClFO3 |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-[5-(4-chloro-2-ethyl-3-fluorophenyl)-2-ethylphenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)c(F)c2CC)cc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C25H28ClFO3/c1-7-14-9-10-15(17-11-12-19(26)21(27)16(17)8-2)13-18(14)20-22(28)24(3,4)30-25(5,6)23(20)29/h9-13,20H,7-8H2,1-6H3 |
| InChIKey | NNAMAJIWYSTHCO-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|