C24H24F3NO6 — CID 123204104
4-[2-ethyl-5-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2,2,6,6-tetramethyloxane-3,5-dione (PubChem CID 123204104) has the molecular formula C24H24F3NO6 and a molecular weight of 479.45 g/mol. Its IUPAC name is 4-[2-ethyl-5-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2,2,6,6-tetramethyloxane-3,5-dione.
| Compound Name | 4-[2-ethyl-5-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
|---|---|
| PubChem CID | 123204104 |
| Molecular Formula | C24H24F3NO6 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 4-[2-ethyl-5-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2,2,6,6-tetramethyloxane-3,5-dione |
| SMILES | CCc1ccc(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1C1C(=O)C(C)(C)OC(C)(C)C1=O |
| InChI | InChI=1S/C24H24F3NO6/c1-6-13-7-9-15(33-18-10-8-14(24(25,26)27)11-17(18)28(31)32)12-16(13)19-20(29)22(2,3)34-23(4,5)21(19)30/h7-12,19H,6H2,1-5H3 |
| InChIKey | XETSUSOLDZKVRG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|