C21H19NO4S — CID 123577163
2-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]cyclopentane-1,3-dione (PubChem CID 123577163) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]cyclopentane-1,3-dione.
| Compound Name | 2-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 123577163 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-[2-ethyl-5-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]cyclopentane-1,3-dione |
| SMILES | CCc1ccc(Oc2nc3ccc(OC)cc3s2)cc1C1C(=O)CCC1=O |
| InChI | InChI=1S/C21H19NO4S/c1-3-12-4-5-14(10-15(12)20-17(23)8-9-18(20)24)26-21-22-16-7-6-13(25-2)11-19(16)27-21/h4-7,10-11,20H,3,8-9H2,1-2H3 |
| InChIKey | YCMLMMIPSSHNRJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|