C19H21N3OS — CID 11279222
1-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]piperidin-4-amine (PubChem CID 11279222) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]piperidin-4-amine.
| Compound Name | 1-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 11279222 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]piperidin-4-amine |
| SMILES | NC1CCN(Cc2ccc(Oc3nc4ccccc4s3)cc2)CC1 |
| InChI | InChI=1S/C19H21N3OS/c20-15-9-11-22(12-10-15)13-14-5-7-16(8-6-14)23-19-21-17-3-1-2-4-18(17)24-19/h1-8,15H,9-13,20H2 |
| InChIKey | BTYHUCROUVOSFY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |