C22H26N4OS2 — CID 59989113
1-[1-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]piperidin-4-yl]-3-ethylthiourea (PubChem CID 59989113) has the molecular formula C22H26N4OS2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-[1-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]piperidin-4-yl]-3-ethylthiourea.
| Compound Name | 1-[1-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]piperidin-4-yl]-3-ethylthiourea |
|---|---|
| PubChem CID | 59989113 |
| Molecular Formula | C22H26N4OS2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-[1-[[4-(1,3-benzothiazol-2-yloxy)phenyl]methyl]piperidin-4-yl]-3-ethylthiourea |
| SMILES | CCNC(=S)NC1CCN(Cc2ccc(Oc3nc4ccccc4s3)cc2)CC1 |
| InChI | InChI=1S/C22H26N4OS2/c1-2-23-21(28)24-17-11-13-26(14-12-17)15-16-7-9-18(10-8-16)27-22-25-19-5-3-4-6-20(19)29-22/h3-10,17H,2,11-15H2,1H3,(H2,23,24,28) |
| InChIKey | PVHZEAUQIFRCJQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|