C25H26BrClO3 — CID 90888103
3-[5-(4-bromo-2-chlorophenoxy)-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione (PubChem CID 90888103) has the molecular formula C25H26BrClO3 and a molecular weight of 489.84 g/mol. Its IUPAC name is 3-[5-(4-bromo-2-chlorophenoxy)-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[5-(4-bromo-2-chlorophenoxy)-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 90888103 |
| Molecular Formula | C25H26BrClO3 |
| Molecular Weight | 489.84 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 3-[5-(4-bromo-2-chlorophenoxy)-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(Oc2ccc(Br)cc2Cl)cc1C1C(=O)C2CCC(C)(C1=O)C2(C)C |
| InChI | InChI=1S/C25H26BrClO3/c1-5-14-6-8-16(30-20-9-7-15(26)12-19(20)27)13-17(14)21-22(28)18-10-11-25(4,23(21)29)24(18,2)3/h6-9,12-13,18,21H,5,10-11H2,1-4H3 |
| InChIKey | CMVIJTKOMOQSAI-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.84 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|