C19H16ClFO3 — CID 123193312
2-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]cyclopentane-1,3-dione (PubChem CID 123193312) has the molecular formula C19H16ClFO3 and a molecular weight of 346.79 g/mol. Its IUPAC name is 2-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]cyclopentane-1,3-dione.
| Compound Name | 2-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 123193312 |
| Molecular Formula | C19H16ClFO3 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]cyclopentane-1,3-dione |
| SMILES | CCc1ccc(Oc2ccc(Cl)cc2F)cc1C1C(=O)CCC1=O |
| InChI | InChI=1S/C19H16ClFO3/c1-2-11-3-5-13(24-18-8-4-12(20)9-15(18)21)10-14(11)19-16(22)6-7-17(19)23/h3-5,8-10,19H,2,6-7H2,1H3 |
| InChIKey | RAJGVGDZZLUCTB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|