C22H19F3O2 — CID 90722662
(1R,5S)-3-[2-methyl-5-[3-(trifluoromethyl)phenyl]phenyl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 90722662) has the molecular formula C22H19F3O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is (1R,5S)-3-[2-methyl-5-[3-(trifluoromethyl)phenyl]phenyl]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S)-3-[2-methyl-5-[3-(trifluoromethyl)phenyl]phenyl]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 90722662 |
| Molecular Formula | C22H19F3O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (1R,5S)-3-[2-methyl-5-[3-(trifluoromethyl)phenyl]phenyl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | Cc1ccc(-c2cccc(C(F)(F)F)c2)cc1C1C(=O)[C@@H]2CC[C@@H](C2)C1=O |
| InChI | InChI=1S/C22H19F3O2/c1-12-5-6-14(13-3-2-4-17(10-13)22(23,24)25)11-18(12)19-20(26)15-7-8-16(9-15)21(19)27/h2-6,10-11,15-16,19H,7-9H2,1H3/t15-,16+,19? |
| InChIKey | YOXQRSGTEOVDJU-MCPYQZEQSA-N |
| XLogP | 5.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|