C15H15ClF3N — CID 166611051
[3-methyl-5-[3-(trifluoromethyl)phenyl]phenyl]methanamine;hydrochloride (PubChem CID 166611051) has the molecular formula C15H15ClF3N and a molecular weight of 301.74 g/mol. Its IUPAC name is [3-methyl-5-[3-(trifluoromethyl)phenyl]phenyl]methanamine;hydrochloride.
| Compound Name | [3-methyl-5-[3-(trifluoromethyl)phenyl]phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 166611051 |
| Molecular Formula | C15H15ClF3N |
| Molecular Weight | 301.74 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | [3-methyl-5-[3-(trifluoromethyl)phenyl]phenyl]methanamine;hydrochloride |
| SMILES | Cc1cc(CN)cc(-c2cccc(C(F)(F)F)c2)c1.Cl |
| InChI | InChI=1S/C15H14F3N.ClH/c1-10-5-11(9-19)7-13(6-10)12-3-2-4-14(8-12)15(16,17)18;/h2-8H,9,19H2,1H3;1H |
| InChIKey | LFYDOPJWZYUELF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.74 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |