C25H27F3N2 — CID 71678762
3-[3-[3-[3-(3-aminopropyl)phenyl]-5-(trifluoromethyl)phenyl]phenyl]propan-1-amine (PubChem CID 71678762) has the molecular formula C25H27F3N2 and a molecular weight of 412.50 g/mol. Its IUPAC name is 3-[3-[3-[3-(3-aminopropyl)phenyl]-5-(trifluoromethyl)phenyl]phenyl]propan-1-amine.
| Compound Name | 3-[3-[3-[3-(3-aminopropyl)phenyl]-5-(trifluoromethyl)phenyl]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 71678762 |
| Molecular Formula | C25H27F3N2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3-[3-[3-[3-(3-aminopropyl)phenyl]-5-(trifluoromethyl)phenyl]phenyl]propan-1-amine |
| SMILES | NCCCc1cccc(-c2cc(-c3cccc(CCCN)c3)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C25H27F3N2/c26-25(27,28)24-16-22(20-9-1-5-18(13-20)7-3-11-29)15-23(17-24)21-10-2-6-19(14-21)8-4-12-30/h1-2,5-6,9-10,13-17H,3-4,7-8,11-12,29-30H2 |
| InChIKey | GQRRCOHUJWLTCG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |