C11H14F3NO — CID 84736382
1-[3-(3-aminopropyl)phenyl]-2,2,2-trifluoroethanol (PubChem CID 84736382) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-[3-(3-aminopropyl)phenyl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[3-(3-aminopropyl)phenyl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 84736382 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-[3-(3-aminopropyl)phenyl]-2,2,2-trifluoroethanol |
| SMILES | NCCCc1cccc(C(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO/c12-11(13,14)10(16)9-5-1-3-8(7-9)4-2-6-15/h1,3,5,7,10,16H,2,4,6,15H2 |
| InChIKey | RZIRRKIIDCYTBL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |