C13H21NO — CID 71229266
3-amino-1-(3-butylphenyl)propan-1-ol (PubChem CID 71229266) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-amino-1-(3-butylphenyl)propan-1-ol.
| Compound Name | 3-amino-1-(3-butylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 71229266 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3-amino-1-(3-butylphenyl)propan-1-ol |
| SMILES | CCCCc1cccc(C(O)CCN)c1 |
| InChI | InChI=1S/C13H21NO/c1-2-3-5-11-6-4-7-12(10-11)13(15)8-9-14/h4,6-7,10,13,15H,2-3,5,8-9,14H2,1H3 |
| InChIKey | XGLNYMDCJMXLBO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |