C17H26FNO2 — CID 174633476
2-fluoro-N-[3-(3-hexylphenyl)-3-hydroxypropyl]acetamide (PubChem CID 174633476) has the molecular formula C17H26FNO2 and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-fluoro-N-[3-(3-hexylphenyl)-3-hydroxypropyl]acetamide.
| Compound Name | 2-fluoro-N-[3-(3-hexylphenyl)-3-hydroxypropyl]acetamide |
|---|---|
| PubChem CID | 174633476 |
| Molecular Formula | C17H26FNO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-fluoro-N-[3-(3-hexylphenyl)-3-hydroxypropyl]acetamide |
| SMILES | CCCCCCc1cccc(C(O)CCNC(=O)CF)c1 |
| InChI | InChI=1S/C17H26FNO2/c1-2-3-4-5-7-14-8-6-9-15(12-14)16(20)10-11-19-17(21)13-18/h6,8-9,12,16,20H,2-5,7,10-11,13H2,1H3,(H,19,21) |
| InChIKey | BJCFVFZLAHHVSO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|