C17H17F9O — CID 162348115
1-(3-butylphenyl)-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethanol (PubChem CID 162348115) has the molecular formula C17H17F9O and a molecular weight of 408.30 g/mol. Its IUPAC name is 1-(3-butylphenyl)-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethanol.
| Compound Name | 1-(3-butylphenyl)-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethanol |
|---|---|
| PubChem CID | 162348115 |
| Molecular Formula | C17H17F9O |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1-(3-butylphenyl)-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethanol |
| SMILES | CCCCc1cccc(C(O)CC2(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)c1 |
| InChI | InChI=1S/C17H17F9O/c1-2-3-5-10-6-4-7-11(8-10)12(27)9-13(18)14(19,20)16(23,24)17(25,26)15(13,21)22/h4,6-8,12,27H,2-3,5,9H2,1H3 |
| InChIKey | LWCWMXDRLPVROB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|