C17H18F9NO — CID 162347694
1-[3-(diethylamino)phenyl]-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethanol (PubChem CID 162347694) has the molecular formula C17H18F9NO and a molecular weight of 423.32 g/mol. Its IUPAC name is 1-[3-(diethylamino)phenyl]-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethanol.
| Compound Name | 1-[3-(diethylamino)phenyl]-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethanol |
|---|---|
| PubChem CID | 162347694 |
| Molecular Formula | C17H18F9NO |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 1-[3-(diethylamino)phenyl]-2-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)ethanol |
| SMILES | CCN(CC)c1cccc(C(O)CC2(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)c1 |
| InChI | InChI=1S/C17H18F9NO/c1-3-27(4-2)11-7-5-6-10(8-11)12(28)9-13(18)14(19,20)16(23,24)17(25,26)15(13,21)22/h5-8,12,28H,3-4,9H2,1-2H3 |
| InChIKey | IHNRTPPNWKEBJE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|