C12H20N2O — CID 117297990
2-amino-1-[3-(diethylamino)phenyl]ethanol (PubChem CID 117297990) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-amino-1-[3-(diethylamino)phenyl]ethanol.
| Compound Name | 2-amino-1-[3-(diethylamino)phenyl]ethanol |
|---|---|
| PubChem CID | 117297990 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-amino-1-[3-(diethylamino)phenyl]ethanol |
| SMILES | CCN(CC)c1cccc(C(O)CN)c1 |
| InChI | InChI=1S/C12H20N2O/c1-3-14(4-2)11-7-5-6-10(8-11)12(15)9-13/h5-8,12,15H,3-4,9,13H2,1-2H3 |
| InChIKey | FGJDBIQDRLQYON-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |