C27H31FI2N6 — CID 163889679
2-[3-[3-[3-[3-[3-(diaminomethylideneamino)propyl]phenyl]-5-[fluoro(diiodo)methyl]phenyl]phenyl]propyl]guanidine (PubChem CID 163889679) has the molecular formula C27H31FI2N6 and a molecular weight of 712.39 g/mol. Its IUPAC name is 2-[3-[3-[3-[3-[3-(diaminomethylideneamino)propyl]phenyl]-5-[fluoro(diiodo)methyl]phenyl]phenyl]propyl]guanidine.
| Compound Name | 2-[3-[3-[3-[3-[3-(diaminomethylideneamino)propyl]phenyl]-5-[fluoro(diiodo)methyl]phenyl]phenyl]propyl]guanidine |
|---|---|
| PubChem CID | 163889679 |
| Molecular Formula | C27H31FI2N6 |
| Molecular Weight | 712.39 g/mol |
| Exact Mass | 712.07 |
| IUPAC Name | 2-[3-[3-[3-[3-[3-(diaminomethylideneamino)propyl]phenyl]-5-[fluoro(diiodo)methyl]phenyl]phenyl]propyl]guanidine |
| SMILES | NC(N)=NCCCc1cccc(-c2cc(-c3cccc(CCCN=C(N)N)c3)cc(C(F)(I)I)c2)c1 |
| InChI | InChI=1S/C27H31FI2N6/c28-27(29,30)24-16-22(20-9-1-5-18(13-20)7-3-11-35-25(31)32)15-23(17-24)21-10-2-6-19(14-21)8-4-12-36-26(33)34/h1-2,5-6,9-10,13-17H,3-4,7-8,11-12H2,(H4,31,32,35)(H4,33,34,36) |
| InChIKey | QALZJDANMXFPHV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|