C15H14F3N — CID 156612413
[3-(4-methylphenyl)-5-(trifluoromethyl)phenyl]methanamine (PubChem CID 156612413) has the molecular formula C15H14F3N and a molecular weight of 265.28 g/mol. Its IUPAC name is [3-(4-methylphenyl)-5-(trifluoromethyl)phenyl]methanamine.
| Compound Name | [3-(4-methylphenyl)-5-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 156612413 |
| Molecular Formula | C15H14F3N |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | [3-(4-methylphenyl)-5-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1ccc(-c2cc(CN)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H14F3N/c1-10-2-4-12(5-3-10)13-6-11(9-19)7-14(8-13)15(16,17)18/h2-8H,9,19H2,1H3 |
| InChIKey | HUBZCTWJKTXFFJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |