C16H14F3NO3 — CID 11587867
2,4-dioxo-N-[3-(trifluoromethyl)phenyl]bicyclo[3.2.1]octane-3-carboxamide (PubChem CID 11587867) has the molecular formula C16H14F3NO3 and a molecular weight of 325.29 g/mol. Its IUPAC name is 2,4-dioxo-N-[3-(trifluoromethyl)phenyl]bicyclo[3.2.1]octane-3-carboxamide.
| Compound Name | 2,4-dioxo-N-[3-(trifluoromethyl)phenyl]bicyclo[3.2.1]octane-3-carboxamide |
|---|---|
| PubChem CID | 11587867 |
| Molecular Formula | C16H14F3NO3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2,4-dioxo-N-[3-(trifluoromethyl)phenyl]bicyclo[3.2.1]octane-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C16H14F3NO3/c17-16(18,19)10-2-1-3-11(7-10)20-15(23)12-13(21)8-4-5-9(6-8)14(12)22/h1-3,7-9,12H,4-6H2,(H,20,23) |
| InChIKey | CEPDXJSMEGWFHT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|