C11H11BrN2O4 — CID 178114565
ethyl 6-bromo-5-methyl-2,4-dioxo-1H-pyrrolo[1,2-b]pyridazine-3-carboxylate (PubChem CID 178114565) has the molecular formula C11H11BrN2O4 and a molecular weight of 315.12 g/mol. Its IUPAC name is ethyl 6-bromo-5-methyl-2,4-dioxo-1H-pyrrolo[1,2-b]pyridazine-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-methyl-2,4-dioxo-1H-pyrrolo[1,2-b]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 178114565 |
| Molecular Formula | C11H11BrN2O4 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | ethyl 6-bromo-5-methyl-2,4-dioxo-1H-pyrrolo[1,2-b]pyridazine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)Nn2cc(Br)c(C)c2C1=O |
| InChI | InChI=1S/C11H11BrN2O4/c1-3-18-11(17)7-9(15)8-5(2)6(12)4-14(8)13-10(7)16/h4,7H,3H2,1-2H3,(H,13,16) |
| InChIKey | MDDBGOAUOHHXJN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|