C11H12N2O5 — CID 175822501
ethyl 5-hydroxy-4,6-dioxo-2,3-dihydro-1H-pyrido[1,2-b]pyridazine-3-carboxylate (PubChem CID 175822501) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is ethyl 5-hydroxy-4,6-dioxo-2,3-dihydro-1H-pyrido[1,2-b]pyridazine-3-carboxylate.
| Compound Name | ethyl 5-hydroxy-4,6-dioxo-2,3-dihydro-1H-pyrido[1,2-b]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 175822501 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | ethyl 5-hydroxy-4,6-dioxo-2,3-dihydro-1H-pyrido[1,2-b]pyridazine-3-carboxylate |
| SMILES | CCOC(=O)C1CNn2ccc(=O)c(O)c2C1=O |
| InChI | InChI=1S/C11H12N2O5/c1-2-18-11(17)6-5-12-13-4-3-7(14)10(16)8(13)9(6)15/h3-4,6,12,16H,2,5H2,1H3 |
| InChIKey | YREIYACGLOKQAC-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|