C11H17NO4 — CID 175903083
ethyl (3R)-1,5,5-trimethyl-2,4-dioxopiperidine-3-carboxylate (PubChem CID 175903083) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is ethyl (3R)-1,5,5-trimethyl-2,4-dioxopiperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1,5,5-trimethyl-2,4-dioxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 175903083 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | ethyl (3R)-1,5,5-trimethyl-2,4-dioxopiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)N(C)CC(C)(C)C1=O |
| InChI | InChI=1S/C11H17NO4/c1-5-16-10(15)7-8(13)11(2,3)6-12(4)9(7)14/h7H,5-6H2,1-4H3/t7-/m1/s1 |
| InChIKey | OJSYPHJKKRTXAY-SSDOTTSWSA-N |
| XLogP | 0.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|