C11H19NO3 — CID 11310404
ethyl 2,2-dimethyl-4-oxo-1-propan-2-ylazetidine-3-carboxylate (PubChem CID 11310404) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-4-oxo-1-propan-2-ylazetidine-3-carboxylate.
| Compound Name | ethyl 2,2-dimethyl-4-oxo-1-propan-2-ylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 11310404 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | ethyl 2,2-dimethyl-4-oxo-1-propan-2-ylazetidine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)N(C(C)C)C1(C)C |
| InChI | InChI=1S/C11H19NO3/c1-6-15-10(14)8-9(13)12(7(2)3)11(8,4)5/h7-8H,6H2,1-5H3 |
| InChIKey | ATLHLMBOMWIORV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|