About ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate
ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate (PubChem CID 142171281) has the molecular formula C9H10O5
and a molecular weight of 198.17 g/mol. Its IUPAC name is ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate.
Analyze ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate?
The IUPAC name of ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate (CID 142171281) is ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate.
What is the SMILES notation for ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate?
The canonical SMILES for ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate is CCOC(=O)C1C=C(O)C(=O)C(O)=C1.
What is the InChIKey of ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate?
The InChIKey is RKBMAFNDVKZEAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O5/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-5,10-11H,2H2,1H3.
What are the key properties of ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate?
ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate has a molecular weight of 198.17 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,5-dihydroxy-4-oxocyclohexa-2,5-diene-1-carboxylate is sourced from PubChem (CID 142171281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).