C13H15IO2 — CID 11566123
ethyl 2-iodo-1,2,3,6-tetrahydroazulene-6-carboxylate (PubChem CID 11566123) has the molecular formula C13H15IO2 and a molecular weight of 330.17 g/mol. Its IUPAC name is ethyl 2-iodo-1,2,3,6-tetrahydroazulene-6-carboxylate.
| Compound Name | ethyl 2-iodo-1,2,3,6-tetrahydroazulene-6-carboxylate |
|---|---|
| PubChem CID | 11566123 |
| Molecular Formula | C13H15IO2 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | ethyl 2-iodo-1,2,3,6-tetrahydroazulene-6-carboxylate |
| SMILES | CCOC(=O)C1C=CC2=C(C=C1)CC(I)C2 |
| InChI | InChI=1S/C13H15IO2/c1-2-16-13(15)9-3-5-10-7-12(14)8-11(10)6-4-9/h3-6,9,12H,2,7-8H2,1H3 |
| InChIKey | DUFKZOUWBIDBOQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|