C9H12ClNO4S — CID 70607452
ethyl 4-chloro-4-sulfamoylcyclohexa-2,5-diene-1-carboxylate (PubChem CID 70607452) has the molecular formula C9H12ClNO4S and a molecular weight of 265.72 g/mol. Its IUPAC name is ethyl 4-chloro-4-sulfamoylcyclohexa-2,5-diene-1-carboxylate.
| Compound Name | ethyl 4-chloro-4-sulfamoylcyclohexa-2,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 70607452 |
| Molecular Formula | C9H12ClNO4S |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | ethyl 4-chloro-4-sulfamoylcyclohexa-2,5-diene-1-carboxylate |
| SMILES | CCOC(=O)C1C=CC(Cl)(S(N)(=O)=O)C=C1 |
| InChI | InChI=1S/C9H12ClNO4S/c1-2-15-8(12)7-3-5-9(10,6-4-7)16(11,13)14/h3-7H,2H2,1H3,(H2,11,13,14) |
| InChIKey | KCKVSXACXPMTKN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|