About sodium;ethyl acetate;iodide
sodium;ethyl acetate;iodide (PubChem CID 175319293) has the molecular formula C4H8INaO2
and a molecular weight of 238.00 g/mol. Its IUPAC name is sodium;ethyl acetate;iodide.
Molecular Properties
| Compound Name | sodium;ethyl acetate;iodide |
| PubChem CID | 175319293 |
| Molecular Formula | C4H8INaO2 |
| Molecular Weight | 238.00 g/mol |
| Exact Mass | 237.95 |
| IUPAC Name | sodium;ethyl acetate;iodide |
| SMILES | CCOC(C)=O.[I-].[Na+] |
| InChI | InChI=1S/C4H8O2.HI.Na/c1-3-6-4(2)5;;/h3H2,1-2H3;1H;/q;;+1/p-1 |
| InChIKey | IWWBBDUJSYGLPX-UHFFFAOYSA-M |
| XLogP | -5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.00 |
| LogP ≤ 5 | -5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethyl acetate;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethyl acetate;iodide?
The IUPAC name of sodium;ethyl acetate;iodide (CID 175319293) is sodium;ethyl acetate;iodide.
What is the SMILES notation for sodium;ethyl acetate;iodide?
The canonical SMILES for sodium;ethyl acetate;iodide is CCOC(C)=O.[I-].[Na+].
What is the InChIKey of sodium;ethyl acetate;iodide?
The InChIKey is IWWBBDUJSYGLPX-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8O2.HI.Na/c1-3-6-4(2)5;;/h3H2,1-2H3;1H;/q;;+1/p-1.
What are the key properties of sodium;ethyl acetate;iodide?
sodium;ethyl acetate;iodide has a molecular weight of 238.00 g/mol, XLogP of -5.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethyl acetate;iodide is sourced from PubChem (CID 175319293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).