About ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate
ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate (PubChem CID 14974581) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate.
Analyze ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate?
The IUPAC name of ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate (CID 14974581) is ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate?
The canonical SMILES for ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate is CCOC(=O)C1=CC(C)(C)N(C(C)C)O1.
What is the InChIKey of ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate?
The InChIKey is SIHFHKALCMPEGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-6-14-10(13)9-7-11(4,5)12(15-9)8(2)3/h7-8H,6H2,1-5H3.
What are the key properties of ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate?
ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate has a molecular weight of 213.28 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,3-dimethyl-2-propan-2-yl-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 14974581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).