About ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol
ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol (PubChem CID 176996283) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol.
Analyze ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol?
The IUPAC name of ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol (CID 176996283) is ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol.
What is the SMILES notation for ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol?
The canonical SMILES for ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol is CCOC(=O)C1=CCC(C)O1.CO.
What is the InChIKey of ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol?
The InChIKey is SMCSLCIMXKQLPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3.CH4O/c1-3-10-8(9)7-5-4-6(2)11-7;1-2/h5-6H,3-4H2,1-2H3;2H,1H3.
What are the key properties of ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol?
ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol has a molecular weight of 188.22 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-2,3-dihydrofuran-5-carboxylate;methanol is sourced from PubChem (CID 176996283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).