About ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate
ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate (PubChem CID 117058868) has the molecular formula C9H15NO4S
and a molecular weight of 233.29 g/mol. Its IUPAC name is ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate.
Analyze ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate?
The IUPAC name of ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate (CID 117058868) is ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate.
What is the SMILES notation for ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate?
The canonical SMILES for ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate is CCOC(=O)C1=CCC(S(=O)CC)ON1.
What is the InChIKey of ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate?
The InChIKey is HSQRLBYXJKIMFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4S/c1-3-13-9(11)7-5-6-8(14-10-7)15(12)4-2/h5,8,10H,3-4,6H2,1-2H3.
What are the key properties of ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate?
ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate has a molecular weight of 233.29 g/mol, XLogP of 0.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-ethylsulfinyl-5,6-dihydro-2H-oxazine-3-carboxylate is sourced from PubChem (CID 117058868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).