C10H13NO2 — CID 23529487
ethyl 1,3a,6,6a-tetrahydrocyclopenta[b]pyrrole-2-carboxylate (PubChem CID 23529487) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is ethyl 1,3a,6,6a-tetrahydrocyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | ethyl 1,3a,6,6a-tetrahydrocyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 23529487 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | ethyl 1,3a,6,6a-tetrahydrocyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)C1=CC2C=CCC2N1 |
| InChI | InChI=1S/C10H13NO2/c1-2-13-10(12)9-6-7-4-3-5-8(7)11-9/h3-4,6-8,11H,2,5H2,1H3 |
| InChIKey | CVOSDTOWLYMDHL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|