C13H21NO2 — CID 91121949
ethane;ethyl 3-methyl-1,3a,4,6a-tetrahydrocyclopenta[b]pyrrole-2-carboxylate (PubChem CID 91121949) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is ethane;ethyl 3-methyl-1,3a,4,6a-tetrahydrocyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | ethane;ethyl 3-methyl-1,3a,4,6a-tetrahydrocyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 91121949 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | ethane;ethyl 3-methyl-1,3a,4,6a-tetrahydrocyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CC.CCOC(=O)C1=C(C)C2CC=CC2N1 |
| InChI | InChI=1S/C11H15NO2.C2H6/c1-3-14-11(13)10-7(2)8-5-4-6-9(8)12-10;1-2/h4,6,8-9,12H,3,5H2,1-2H3;1-2H3 |
| InChIKey | NPLCTZPLOMIAJJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|