About ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate
ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 91508265) has the molecular formula C7H11NO4
and a molecular weight of 173.17 g/mol. Its IUPAC name is ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate.
Analyze ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate (CID 91508265) is ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate is CCOC(=O)C1=CC(CO)ON1.
What is the InChIKey of ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate?
The InChIKey is ROCOQKILJCGKQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4/c1-2-11-7(10)6-3-5(4-9)12-8-6/h3,5,8-9H,2,4H2,1H3.
What are the key properties of ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate?
ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate has a molecular weight of 173.17 g/mol, XLogP of -0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(hydroxymethyl)-2,5-dihydro-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 91508265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).