C32H34N4O3 — CID 57122318
ethyl 5-[4-[(1-tritylimidazol-2-yl)amino]butyl]-2,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 57122318) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is ethyl 5-[4-[(1-tritylimidazol-2-yl)amino]butyl]-2,5-dihydro-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[4-[(1-tritylimidazol-2-yl)amino]butyl]-2,5-dihydro-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 57122318 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | ethyl 5-[4-[(1-tritylimidazol-2-yl)amino]butyl]-2,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=CC(CCCCNc2nccn2C(c2ccccc2)(c2ccccc2)c2ccccc2)ON1 |
| InChI | InChI=1S/C32H34N4O3/c1-2-38-30(37)29-24-28(39-35-29)20-12-13-21-33-31-34-22-23-36(31)32(25-14-6-3-7-15-25,26-16-8-4-9-17-26)27-18-10-5-11-19-27/h3-11,14-19,22-24,28,35H,2,12-13,20-21H2,1H3,(H,33,34) |
| InChIKey | VPNSYRZUBLKHKS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|