C31H32N6O4 — CID 160664083
ethyl 5-methyl-2H-triazole-4-carboxylate;ethyl 5-methyl-2-trityltriazole-4-carboxylate (PubChem CID 160664083) has the molecular formula C31H32N6O4 and a molecular weight of 552.64 g/mol. Its IUPAC name is ethyl 5-methyl-2H-triazole-4-carboxylate;ethyl 5-methyl-2-trityltriazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-2H-triazole-4-carboxylate;ethyl 5-methyl-2-trityltriazole-4-carboxylate |
|---|---|
| PubChem CID | 160664083 |
| Molecular Formula | C31H32N6O4 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | ethyl 5-methyl-2H-triazole-4-carboxylate;ethyl 5-methyl-2-trityltriazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1C.CCOC(=O)c1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)nc1C |
| InChI | InChI=1S/C25H23N3O2.C6H9N3O2/c1-3-30-24(29)23-19(2)26-28(27-23)25(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;1-3-11-6(10)5-4(2)7-9-8-5/h4-18H,3H2,1-2H3;3H2,1-2H3,(H,7,8,9) |
| InChIKey | RMBDWJLKEHOZJI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|