C30H25N3O3 — CID 169400227
ethyl 5-(4-trityloxyphenyl)-2H-triazole-4-carboxylate (PubChem CID 169400227) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is ethyl 5-(4-trityloxyphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(4-trityloxyphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400227 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | ethyl 5-(4-trityloxyphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(OC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25N3O3/c1-2-35-29(34)28-27(31-33-32-28)22-18-20-26(21-19-22)36-30(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-21H,2H2,1H3,(H,31,32,33) |
| InChIKey | AFQQTOBRHLHDGG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|