C49H53N7O5S — CID 18660427
tert-butyl (2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoate (PubChem CID 18660427) has the molecular formula C49H53N7O5S and a molecular weight of 852.07 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 18660427 |
| Molecular Formula | C49H53N7O5S |
| Molecular Weight | 852.07 g/mol |
| Exact Mass | 851.38 |
| IUPAC Name | tert-butyl (2S)-2-[(2,4,6-trimethylphenyl)sulfonylamino]-3-[[1-[3-[(1-tritylimidazol-2-yl)amino]propyl]indazole-5-carbonyl]amino]propanoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@@H](CNC(=O)c2ccc3c(cnn3CCCNc3nccn3C(c3ccccc3)(c3ccccc3)c3ccccc3)c2)C(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C49H53N7O5S/c1-34-29-35(2)44(36(3)30-34)62(59,60)54-42(46(58)61-48(4,5)6)33-52-45(57)37-23-24-43-38(31-37)32-53-56(43)27-16-25-50-47-51-26-28-55(47)49(39-17-10-7-11-18-39,40-19-12-8-13-20-40)41-21-14-9-15-22-41/h7-15,17-24,26,28-32,42,54H,16,25,27,33H2,1-6H3,(H,50,51)(H,52,57)/t42-/m0/s1 |
| InChIKey | WYIWXBKIHOJBQM-WBCKFURZSA-N |
| XLogP | 7.92 |
| TPSA | 149.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.07 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|